C27H24N2O6 — CID 5433387
methyl 3-[5-[(Z)-[3-methyl-5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 5433387) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is methyl 3-[5-[(Z)-[3-methyl-5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-[(Z)-[3-methyl-5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 5433387 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | methyl 3-[5-[(Z)-[3-methyl-5-oxo-1-(4-propan-2-yloxycarbonylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(/C=C3\C(=O)N(c4ccc(C(=O)OC(C)C)cc4)N=C3C)o2)c1 |
| InChI | InChI=1S/C27H24N2O6/c1-16(2)34-27(32)18-8-10-21(11-9-18)29-25(30)23(17(3)28-29)15-22-12-13-24(35-22)19-6-5-7-20(14-19)26(31)33-4/h5-16H,1-4H3/b23-15- |
| InChIKey | JDJFJJPBJPQEBM-HAHDFKILSA-N |
| XLogP | 5.10 |
| TPSA | 98.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|