C26H21F3N2O4 — CID 6531184
propan-2-yl 4-[5-[(E)-[3-methyl-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 6531184) has the molecular formula C26H21F3N2O4 and a molecular weight of 482.46 g/mol. Its IUPAC name is propan-2-yl 4-[5-[(E)-[3-methyl-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | propan-2-yl 4-[5-[(E)-[3-methyl-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6531184 |
| Molecular Formula | C26H21F3N2O4 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | propan-2-yl 4-[5-[(E)-[3-methyl-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CC1=NN(c2cccc(C(F)(F)F)c2)C(=O)/C1=C/c1ccc(-c2ccc(C(=O)OC(C)C)cc2)o1 |
| InChI | InChI=1S/C26H21F3N2O4/c1-15(2)34-25(33)18-9-7-17(8-10-18)23-12-11-21(35-23)14-22-16(3)30-31(24(22)32)20-6-4-5-19(13-20)26(27,28)29/h4-15H,1-3H3/b22-14+ |
| InChIKey | HNELCBQFCUTVTB-HYARGMPZSA-N |
| XLogP | 6.34 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|