C30H18N2O6 — CID 50888185
3-[(4E)-4-[[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 50888185) has the molecular formula C30H18N2O6 and a molecular weight of 502.48 g/mol. Its IUPAC name is 3-[(4E)-4-[[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 3-[(4E)-4-[[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50888185 |
| Molecular Formula | C30H18N2O6 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 3-[(4E)-4-[[5-(9,10-dioxoanthracen-2-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2cccc(C(=O)O)c2)C(=O)/C1=C/c1ccc(-c2ccc3c(c2)C(=O)c2ccccc2C3=O)o1 |
| InChI | InChI=1S/C30H18N2O6/c1-16-24(29(35)32(31-16)19-6-4-5-18(13-19)30(36)37)15-20-10-12-26(38-20)17-9-11-23-25(14-17)28(34)22-8-3-2-7-21(22)27(23)33/h2-15H,1H3,(H,36,37)/b24-15+ |
| InChIKey | QAFJUNSPLVNJQX-BUVRLJJBSA-N |
| XLogP | 5.23 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|