C26H19N3O6 — CID 1265935
4-[(4E)-4-[[5-(2-ethyl-1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 1265935) has the molecular formula C26H19N3O6 and a molecular weight of 469.45 g/mol. Its IUPAC name is 4-[(4E)-4-[[5-(2-ethyl-1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4E)-4-[[5-(2-ethyl-1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 1265935 |
| Molecular Formula | C26H19N3O6 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 4-[(4E)-4-[[5-(2-ethyl-1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CCN1C(=O)c2ccc(-c3ccc(/C=C4/C(=O)N(c5ccc(C(=O)O)cc5)N=C4C)o3)cc2C1=O |
| InChI | InChI=1S/C26H19N3O6/c1-3-28-23(30)19-10-6-16(12-21(19)24(28)31)22-11-9-18(35-22)13-20-14(2)27-29(25(20)32)17-7-4-15(5-8-17)26(33)34/h4-13H,3H2,1-2H3,(H,33,34)/b20-13+ |
| InChIKey | NTTXNJCLPKOFGL-DEDYPNTBSA-N |
| XLogP | 4.07 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|