C23H19ClN2O2 — CID 6521159
(4E)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one (PubChem CID 6521159) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is (4E)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one.
| Compound Name | (4E)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 6521159 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (4E)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-methyl-2-(4-methylphenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C)cc2)C(=O)/C1=C/c1ccc(-c2ccc(C)c(Cl)c2)o1 |
| InChI | InChI=1S/C23H19ClN2O2/c1-14-4-8-18(9-5-14)26-23(27)20(16(3)25-26)13-19-10-11-22(28-19)17-7-6-15(2)21(24)12-17/h4-13H,1-3H3/b20-13+ |
| InChIKey | MZGUQJGIYALWQA-DEDYPNTBSA-N |
| XLogP | 6.02 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|