C23H14ClF3N2O4 — CID 2293309
4-[(4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid (PubChem CID 2293309) has the molecular formula C23H14ClF3N2O4 and a molecular weight of 474.82 g/mol. Its IUPAC name is 4-[(4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 2293309 |
| Molecular Formula | C23H14ClF3N2O4 |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 4-[(4Z)-4-[[5-(3-chloro-4-methylphenyl)furan-2-yl]methylidene]-5-oxo-3-(trifluoromethyl)pyrazol-1-yl]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(/C=C3\C(=O)N(c4ccc(C(=O)O)cc4)N=C3C(F)(F)F)o2)cc1Cl |
| InChI | InChI=1S/C23H14ClF3N2O4/c1-12-2-3-14(10-18(12)24)19-9-8-16(33-19)11-17-20(23(25,26)27)28-29(21(17)30)15-6-4-13(5-7-15)22(31)32/h2-11H,1H3,(H,31,32)/b17-11- |
| InChIKey | HBLCYWLNWUWQNR-BOPFTXTBSA-N |
| XLogP | 5.96 |
| TPSA | 83.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|