C30H22ClN3O5 — CID 158380041
4-[(4Z)-4-[[5-[4-chloro-3-[(3-methylphenyl)carbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 158380041) has the molecular formula C30H22ClN3O5 and a molecular weight of 539.98 g/mol. Its IUPAC name is 4-[(4Z)-4-[[5-[4-chloro-3-[(3-methylphenyl)carbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-4-[[5-[4-chloro-3-[(3-methylphenyl)carbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 158380041 |
| Molecular Formula | C30H22ClN3O5 |
| Molecular Weight | 539.98 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 4-[(4Z)-4-[[5-[4-chloro-3-[(3-methylphenyl)carbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)c(C(=O)Nc3cccc(C)c3)c2)o1 |
| InChI | InChI=1S/C30H22ClN3O5/c1-17-4-3-5-21(14-17)32-28(35)25-15-20(8-12-26(25)31)27-13-11-23(39-27)16-24-18(2)33-34(29(24)36)22-9-6-19(7-10-22)30(37)38/h3-16H,1-2H3,(H,32,35)(H,37,38)/b24-16- |
| InChIKey | NPALSOJRTSCGOG-JLPGSUDCSA-N |
| XLogP | 6.67 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.98 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|