C23H15ClN2O6 — CID 75072849
5-[5-[[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 75072849) has the molecular formula C23H15ClN2O6 and a molecular weight of 450.83 g/mol. Its IUPAC name is 5-[5-[[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[5-[[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 75072849 |
| Molecular Formula | C23H15ClN2O6 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 5-[5-[[1-(4-carboxyphenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)C1=Cc1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C23H15ClN2O6/c1-12-17(21(27)26(25-12)15-5-2-13(3-6-15)22(28)29)11-16-7-9-20(32-16)14-4-8-19(24)18(10-14)23(30)31/h2-11H,1H3,(H,28,29)(H,30,31) |
| InChIKey | DECFAWZERNPQOF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|