C24H15N3O6 — CID 1278105
4-[4-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 1278105) has the molecular formula C24H15N3O6 and a molecular weight of 441.40 g/mol. Its IUPAC name is 4-[4-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 4-[4-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 1278105 |
| Molecular Formula | C24H15N3O6 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-[4-[[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)C1=Cc1ccc(-c2ccc3c(c2)C(=O)NC3=O)o1 |
| InChI | InChI=1S/C24H15N3O6/c1-12-18(23(30)27(26-12)15-5-2-13(3-6-15)24(31)32)11-16-7-9-20(33-16)14-4-8-17-19(10-14)22(29)25-21(17)28/h2-11H,1H3,(H,31,32)(H,25,28,29) |
| InChIKey | OYACSVJNILASJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|