C31H26FN3O5 — CID 165087693
4-[(4Z)-4-[[5-[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;methane (PubChem CID 165087693) has the molecular formula C31H26FN3O5 and a molecular weight of 539.56 g/mol. Its IUPAC name is 4-[(4Z)-4-[[5-[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;methane.
| Compound Name | 4-[(4Z)-4-[[5-[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;methane |
|---|---|
| PubChem CID | 165087693 |
| Molecular Formula | C31H26FN3O5 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 4-[(4Z)-4-[[5-[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]furan-2-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;methane |
| SMILES | C.CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\c1ccc(-c2ccc(C(=O)NCc3ccc(F)cc3)cc2)o1 |
| InChI | InChI=1S/C30H22FN3O5.CH4/c1-18-26(29(36)34(33-18)24-12-8-22(9-13-24)30(37)38)16-25-14-15-27(39-25)20-4-6-21(7-5-20)28(35)32-17-19-2-10-23(31)11-3-19;/h2-16H,17H2,1H3,(H,32,35)(H,37,38);1H4/b26-16-; |
| InChIKey | WDYFQDSTEJSYSQ-JCCIBZBCSA-N |
| XLogP | 6.16 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|