C21H14ClFN2O2 — CID 5290943
(4E)-2-(3-chlorophenyl)-4-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one (PubChem CID 5290943) has the molecular formula C21H14ClFN2O2 and a molecular weight of 380.81 g/mol. Its IUPAC name is (4E)-2-(3-chlorophenyl)-4-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4E)-2-(3-chlorophenyl)-4-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 5290943 |
| Molecular Formula | C21H14ClFN2O2 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (4E)-2-(3-chlorophenyl)-4-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)/C1=C/c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C21H14ClFN2O2/c1-13-19(21(26)25(24-13)17-4-2-3-15(22)11-17)12-18-9-10-20(27-18)14-5-7-16(23)8-6-14/h2-12H,1H3/b19-12+ |
| InChIKey | KFIAGZKQQLLMLN-XDHOZWIPSA-N |
| XLogP | 5.55 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|