C23H15ClN2O4 — CID 5442551
(4Z)-2-(3-chlorophenyl)-5-methyl-4-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyrazol-3-one (PubChem CID 5442551) has the molecular formula C23H15ClN2O4 and a molecular weight of 418.84 g/mol. Its IUPAC name is (4Z)-2-(3-chlorophenyl)-5-methyl-4-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyrazol-3-one.
| Compound Name | (4Z)-2-(3-chlorophenyl)-5-methyl-4-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 5442551 |
| Molecular Formula | C23H15ClN2O4 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | (4Z)-2-(3-chlorophenyl)-5-methyl-4-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]methylidene]pyrazol-3-one |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)/C1=C\c1ccc(-c2ccc3c(c2)COC3=O)o1 |
| InChI | InChI=1S/C23H15ClN2O4/c1-13-20(22(27)26(25-13)17-4-2-3-16(24)10-17)11-18-6-8-21(30-18)14-5-7-19-15(9-14)12-29-23(19)28/h2-11H,12H2,1H3/b20-11- |
| InChIKey | DELFQMFYMHQQHD-JAIQZWGSSA-N |
| XLogP | 5.08 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|