C23H16N2O5 — CID 50887952
(4Z)-5-methyl-4-[[5-(4-oxo-1,3-benzodioxin-7-yl)furan-2-yl]methylidene]-2-phenylpyrazol-3-one (PubChem CID 50887952) has the molecular formula C23H16N2O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is (4Z)-5-methyl-4-[[5-(4-oxo-1,3-benzodioxin-7-yl)furan-2-yl]methylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-5-methyl-4-[[5-(4-oxo-1,3-benzodioxin-7-yl)furan-2-yl]methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 50887952 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (4Z)-5-methyl-4-[[5-(4-oxo-1,3-benzodioxin-7-yl)furan-2-yl]methylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(-c2ccc3c(c2)OCOC3=O)o1 |
| InChI | InChI=1S/C23H16N2O5/c1-14-19(22(26)25(24-14)16-5-3-2-4-6-16)12-17-8-10-20(30-17)15-7-9-18-21(11-15)28-13-29-23(18)27/h2-12H,13H2,1H3/b19-12- |
| InChIKey | XAIDVYLXXVAAQE-UNOMPAQXSA-N |
| XLogP | 4.26 |
| TPSA | 81.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|