C21H15ClN2O2 — CID 6262054
(4Z)-4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 6262054) has the molecular formula C21H15ClN2O2 and a molecular weight of 362.82 g/mol. Its IUPAC name is (4Z)-4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6262054 |
| Molecular Formula | C21H15ClN2O2 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (4Z)-4-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H15ClN2O2/c1-14-19(21(25)24(23-14)17-5-3-2-4-6-17)13-18-11-12-20(26-18)15-7-9-16(22)10-8-15/h2-13H,1H3/b19-13- |
| InChIKey | WFQUMDLRPKUCIE-UYRXBGFRSA-N |
| XLogP | 5.41 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|