C22H15N2O4- — CID 7266464
4-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 7266464) has the molecular formula C22H15N2O4- and a molecular weight of 371.37 g/mol. Its IUPAC name is 4-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 4-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7266464 |
| Molecular Formula | C22H15N2O4- |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-[5-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(-c2ccc(C(=O)[O-])cc2)o1 |
| InChI | InChI=1S/C22H16N2O4/c1-14-19(21(25)24(23-14)17-5-3-2-4-6-17)13-18-11-12-20(28-18)15-7-9-16(10-8-15)22(26)27/h2-13H,1H3,(H,26,27)/p-1/b19-13- |
| InChIKey | GUDOENKDQFFNED-UYRXBGFRSA-M |
| XLogP | 3.12 |
| TPSA | 85.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|