C18H13N2O3- — CID 7369363
4-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]benzoate (PubChem CID 7369363) has the molecular formula C18H13N2O3- and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]benzoate.
| Compound Name | 4-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 7369363 |
| Molecular Formula | C18H13N2O3- |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[(Z)-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)methyl]benzoate |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H14N2O3/c1-12-16(11-13-7-9-14(10-8-13)18(22)23)17(21)20(19-12)15-5-3-2-4-6-15/h2-11H,1H3,(H,22,23)/p-1/b16-11- |
| InChIKey | ADZQDMRTRBCTQK-WJDWOHSUSA-M |
| XLogP | 1.86 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|