C20H14N2O6-2 — CID 7428603
4-[(4E)-4-[[4-(carboxylatomethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate (PubChem CID 7428603) has the molecular formula C20H14N2O6-2 and a molecular weight of 378.34 g/mol. Its IUPAC name is 4-[(4E)-4-[[4-(carboxylatomethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate.
| Compound Name | 4-[(4E)-4-[[4-(carboxylatomethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 7428603 |
| Molecular Formula | C20H14N2O6-2 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-[(4E)-4-[[4-(carboxylatomethoxy)phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoate |
| SMILES | CC1=NN(c2ccc(C(=O)[O-])cc2)C(=O)/C1=C/c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C20H16N2O6/c1-12-17(10-13-2-8-16(9-3-13)28-11-18(23)24)19(25)22(21-12)15-6-4-14(5-7-15)20(26)27/h2-10H,11H2,1H3,(H,23,24)(H,26,27)/p-2/b17-10+ |
| InChIKey | PJKSHSVPPIPSRX-LICLKQGHSA-L |
| XLogP | -0.02 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|