C25H31N3O4 — CID 143348921
4-[(4Z)-4-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;ethane (PubChem CID 143348921) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[(4Z)-4-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;ethane.
| Compound Name | 4-[(4Z)-4-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;ethane |
|---|---|
| PubChem CID | 143348921 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 4-[(4Z)-4-[[4-[3-(dimethylamino)propoxy]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid;ethane |
| SMILES | CC.CC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\c1ccc(OCCCN(C)C)cc1 |
| InChI | InChI=1S/C23H25N3O4.C2H6/c1-16-21(15-17-5-11-20(12-6-17)30-14-4-13-25(2)3)22(27)26(24-16)19-9-7-18(8-10-19)23(28)29;1-2/h5-12,15H,4,13-14H2,1-3H3,(H,28,29);1-2H3/b21-15-; |
| InChIKey | DWHBPHDISHWNCD-XGRJIHFXSA-N |
| XLogP | 4.55 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|