C25H19FN2O4 — CID 2939329
prop-2-enyl 3-[5-[[1-(4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2939329) has the molecular formula C25H19FN2O4 and a molecular weight of 430.44 g/mol. Its IUPAC name is prop-2-enyl 3-[5-[[1-(4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | prop-2-enyl 3-[5-[[1-(4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2939329 |
| Molecular Formula | C25H19FN2O4 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | prop-2-enyl 3-[5-[[1-(4-fluorophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | C=CCOC(=O)c1cccc(-c2ccc(C=C3C(=O)N(c4ccc(F)cc4)N=C3C)o2)c1 |
| InChI | InChI=1S/C25H19FN2O4/c1-3-13-31-25(30)18-6-4-5-17(14-18)23-12-11-21(32-23)15-22-16(2)27-28(24(22)29)20-9-7-19(26)8-10-20/h3-12,14-15H,1,13H2,2H3 |
| InChIKey | BKJLMDWYDOEDQW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|