C25H18BrClN2O4 — CID 3116341
prop-2-enyl 5-[5-[[1-(3-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 3116341) has the molecular formula C25H18BrClN2O4 and a molecular weight of 525.79 g/mol. Its IUPAC name is prop-2-enyl 5-[5-[[1-(3-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | prop-2-enyl 5-[5-[[1-(3-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 3116341 |
| Molecular Formula | C25H18BrClN2O4 |
| Molecular Weight | 525.79 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | prop-2-enyl 5-[5-[[1-(3-bromophenyl)-3-methyl-5-oxopyrazol-4-ylidene]methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | C=CCOC(=O)c1cc(-c2ccc(C=C3C(=O)N(c4cccc(Br)c4)N=C3C)o2)ccc1Cl |
| InChI | InChI=1S/C25H18BrClN2O4/c1-3-11-32-25(31)21-12-16(7-9-22(21)27)23-10-8-19(33-23)14-20-15(2)28-29(24(20)30)18-6-4-5-17(26)13-18/h3-10,12-14H,1,11H2,2H3 |
| InChIKey | FSFWQFHIOOWXNF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|