C21H18N2O6 — CID 6530114
ethyl 3-[5-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 6530114) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is ethyl 3-[5-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6530114 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | ethyl 3-[5-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | C=CCN1C(=O)NC(=O)/C(=C/c2ccc(-c3cccc(C(=O)OCC)c3)o2)C1=O |
| InChI | InChI=1S/C21H18N2O6/c1-3-10-23-19(25)16(18(24)22-21(23)27)12-15-8-9-17(29-15)13-6-5-7-14(11-13)20(26)28-4-2/h3,5-9,11-12H,1,4,10H2,2H3,(H,22,24,27)/b16-12- |
| InChIKey | YDEWTJVHUPDCKQ-VBKFSLOCSA-N |
| XLogP | 2.77 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|