C18H12ClN3O6 — CID 50871744
(5Z)-5-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 50871744) has the molecular formula C18H12ClN3O6 and a molecular weight of 401.76 g/mol. Its IUPAC name is (5Z)-5-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50871744 |
| Molecular Formula | C18H12ClN3O6 |
| Molecular Weight | 401.76 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (5Z)-5-[[5-(3-chloro-4-nitrophenyl)furan-2-yl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)/C(=C/c2ccc(-c3ccc([N+](=O)[O-])c(Cl)c3)o2)C1=O |
| InChI | InChI=1S/C18H12ClN3O6/c1-2-7-21-17(24)12(16(23)20-18(21)25)9-11-4-6-15(28-11)10-3-5-14(22(26)27)13(19)8-10/h2-6,8-9H,1,7H2,(H,20,23,25)/b12-9- |
| InChIKey | VUAYRBSOOCKBQI-XFXZXTDPSA-N |
| XLogP | 3.16 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|