C12H9IN2O4 — CID 7320294
(5E)-5-[(5-iodofuran-2-yl)methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 7320294) has the molecular formula C12H9IN2O4 and a molecular weight of 372.12 g/mol. Its IUPAC name is (5E)-5-[(5-iodofuran-2-yl)methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(5-iodofuran-2-yl)methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7320294 |
| Molecular Formula | C12H9IN2O4 |
| Molecular Weight | 372.12 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | (5E)-5-[(5-iodofuran-2-yl)methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)/C(=C\c2ccc(I)o2)C1=O |
| InChI | InChI=1S/C12H9IN2O4/c1-2-5-15-11(17)8(10(16)14-12(15)18)6-7-3-4-9(13)19-7/h2-4,6H,1,5H2,(H,14,16,18)/b8-6+ |
| InChIKey | DHLKALAZBKWMKJ-SOFGYWHQSA-N |
| XLogP | 1.53 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|