C17H12Cl2N2O2S — CID 73335813
(5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 73335813) has the molecular formula C17H12Cl2N2O2S and a molecular weight of 379.27 g/mol. Its IUPAC name is (5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 73335813 |
| Molecular Formula | C17H12Cl2N2O2S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (5E)-5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)NC1=S |
| InChI | InChI=1S/C17H12Cl2N2O2S/c1-2-7-21-16(22)14(20-17(21)24)9-11-4-6-15(23-11)10-3-5-12(18)13(19)8-10/h2-6,8-9H,1,7H2,(H,20,24)/b14-9+ |
| InChIKey | YFLCKDPSAAXTRC-NTEUORMPSA-N |
| XLogP | 4.50 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|