C17H13BrN2O3 — CID 5431381
(5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 5431381) has the molecular formula C17H13BrN2O3 and a molecular weight of 373.21 g/mol. Its IUPAC name is (5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5431381 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | (5Z)-5-[[5-(3-bromophenyl)furan-2-yl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C\c2ccc(-c3cccc(Br)c3)o2)C1=O |
| InChI | InChI=1S/C17H13BrN2O3/c1-2-8-20-16(21)14(19-17(20)22)10-13-6-7-15(23-13)11-4-3-5-12(18)9-11/h2-7,9-10H,1,8H2,(H,19,22)/b14-10- |
| InChIKey | XMAJTCDEXDLHMC-UVTDQMKNSA-N |
| XLogP | 3.79 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|