C21H14Cl2N2O3 — CID 5225466
5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(4-chlorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 5225466) has the molecular formula C21H14Cl2N2O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is 5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(4-chlorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(4-chlorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5225466 |
| Molecular Formula | C21H14Cl2N2O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 5-[[5-(3-chlorophenyl)furan-2-yl]methylidene]-3-[(4-chlorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=Cc2ccc(-c3cccc(Cl)c3)o2)C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O3/c22-15-6-4-13(5-7-15)12-25-20(26)18(24-21(25)27)11-17-8-9-19(28-17)14-2-1-3-16(23)10-14/h1-11H,12H2,(H,24,27) |
| InChIKey | QIGBIECHXAPIDO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|