C22H15ClN2O5 — CID 126204116
4-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 126204116) has the molecular formula C22H15ClN2O5 and a molecular weight of 422.82 g/mol. Its IUPAC name is 4-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 4-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 126204116 |
| Molecular Formula | C22H15ClN2O5 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 4-[5-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(/C=C3\NC(=O)N(Cc4ccccc4)C3=O)o2)cc1Cl |
| InChI | InChI=1S/C22H15ClN2O5/c23-17-10-14(6-8-16(17)21(27)28)19-9-7-15(30-19)11-18-20(26)25(22(29)24-18)12-13-4-2-1-3-5-13/h1-11H,12H2,(H,24,29)(H,27,28)/b18-11- |
| InChIKey | REHSJGOBIOYYSV-WQRHYEAKSA-N |
| XLogP | 4.39 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|