C21H13ClN2O5 — CID 4639444
2-chloro-5-[5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 4639444) has the molecular formula C21H13ClN2O5 and a molecular weight of 408.80 g/mol. Its IUPAC name is 2-chloro-5-[5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4639444 |
| Molecular Formula | C21H13ClN2O5 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-chloro-5-[5-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C=C3NC(=O)N(c4ccccc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C21H13ClN2O5/c22-16-8-6-12(10-15(16)20(26)27)18-9-7-14(29-18)11-17-19(25)24(21(28)23-17)13-4-2-1-3-5-13/h1-11H,(H,23,28)(H,26,27) |
| InChIKey | QBCJHAKYAHFFKF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|