C28H17ClN2O5S — CID 50873501
2-chloro-5-[5-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 50873501) has the molecular formula C28H17ClN2O5S and a molecular weight of 528.97 g/mol. Its IUPAC name is 2-chloro-5-[5-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 50873501 |
| Molecular Formula | C28H17ClN2O5S |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 2-chloro-5-[5-[(4,6-dioxo-1,3-diphenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C=C3C(=O)N(c4ccccc4)C(=S)N(c4ccccc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C28H17ClN2O5S/c29-23-13-11-17(15-21(23)27(34)35)24-14-12-20(36-24)16-22-25(32)30(18-7-3-1-4-8-18)28(37)31(26(22)33)19-9-5-2-6-10-19/h1-16H,(H,34,35) |
| InChIKey | KIPVOEDGFICTBA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|