C21H11ClO5 — CID 985055
2-chloro-4-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 985055) has the molecular formula C21H11ClO5 and a molecular weight of 378.77 g/mol. Its IUPAC name is 2-chloro-4-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 985055 |
| Molecular Formula | C21H11ClO5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2-chloro-4-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C=C3C(=O)c4ccccc4C3=O)o2)cc1Cl |
| InChI | InChI=1S/C21H11ClO5/c22-17-9-11(5-7-15(17)21(25)26)18-8-6-12(27-18)10-16-19(23)13-3-1-2-4-14(13)20(16)24/h1-10H,(H,25,26) |
| InChIKey | MXIMHBBTDFJEHV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|