C22H14O5 — CID 91010798
2-[[5-(3-acetyl-4-hydroxyphenyl)furan-2-yl]methylidene]indene-1,3-dione (PubChem CID 91010798) has the molecular formula C22H14O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-[[5-(3-acetyl-4-hydroxyphenyl)furan-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-(3-acetyl-4-hydroxyphenyl)furan-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 91010798 |
| Molecular Formula | C22H14O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[[5-(3-acetyl-4-hydroxyphenyl)furan-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC(=O)c1cc(-c2ccc(C=C3C(=O)c4ccccc4C3=O)o2)ccc1O |
| InChI | InChI=1S/C22H14O5/c1-12(23)17-10-13(6-8-19(17)24)20-9-7-14(27-20)11-18-21(25)15-4-2-3-5-16(15)22(18)26/h2-11,24H,1H3 |
| InChIKey | XWNZISDLOBGCLJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|