C22H13ClO5 — CID 126398267
methyl 2-chloro-5-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 126398267) has the molecular formula C22H13ClO5 and a molecular weight of 392.79 g/mol. Its IUPAC name is methyl 2-chloro-5-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126398267 |
| Molecular Formula | C22H13ClO5 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | methyl 2-chloro-5-[5-[(1,3-dioxoinden-2-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(C=C3C(=O)c4ccccc4C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C22H13ClO5/c1-27-22(26)16-10-12(6-8-18(16)23)19-9-7-13(28-19)11-17-20(24)14-4-2-3-5-15(14)21(17)25/h2-11H,1H3 |
| InChIKey | ZLBYAWXARMCWLS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|