C29H29ClN2O6 — CID 5173296
methyl 5-[5-[[1-[1-(1-adamantyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 5173296) has the molecular formula C29H29ClN2O6 and a molecular weight of 537.01 g/mol. Its IUPAC name is methyl 5-[5-[[1-[1-(1-adamantyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | methyl 5-[5-[[1-[1-(1-adamantyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 5173296 |
| Molecular Formula | C29H29ClN2O6 |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | methyl 5-[5-[[1-[1-(1-adamantyl)ethyl]-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(-c2ccc(C=C3C(=O)NC(=O)N(C(C)C45CC6CC(CC(C6)C4)C5)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C29H29ClN2O6/c1-15(29-12-16-7-17(13-29)9-18(8-16)14-29)32-26(34)22(25(33)31-28(32)36)11-20-4-6-24(38-20)19-3-5-23(30)21(10-19)27(35)37-2/h3-6,10-11,15-18H,7-9,12-14H2,1-2H3,(H,31,33,36) |
| InChIKey | JIQXMZFUBZDTEC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|