C24H17ClN2O6 — CID 1395472
methyl 4-[5-[[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 1395472) has the molecular formula C24H17ClN2O6 and a molecular weight of 464.86 g/mol. Its IUPAC name is methyl 4-[5-[[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 1395472 |
| Molecular Formula | C24H17ClN2O6 |
| Molecular Weight | 464.86 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | methyl 4-[5-[[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C=C3C(=O)NC(=O)N(c4ccc(C)c(Cl)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H17ClN2O6/c1-13-3-8-16(11-19(13)25)27-22(29)18(21(28)26-24(27)31)12-17-9-10-20(33-17)14-4-6-15(7-5-14)23(30)32-2/h3-12H,1-2H3,(H,26,28,31) |
| InChIKey | AZLPFBYXPMKTOB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|