C22H14ClFN2O4 — CID 1290246
1-(3-chloro-4-methylphenyl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1290246) has the molecular formula C22H14ClFN2O4 and a molecular weight of 424.82 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1290246 |
| Molecular Formula | C22H14ClFN2O4 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(-c4ccc(F)cc4)o3)C2=O)cc1Cl |
| InChI | InChI=1S/C22H14ClFN2O4/c1-12-2-7-15(10-18(12)23)26-21(28)17(20(27)25-22(26)29)11-16-8-9-19(30-16)13-3-5-14(24)6-4-13/h2-11H,1H3,(H,25,27,29) |
| InChIKey | ACSGMTPBPUXPTB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|