C23H13Cl2N2O6- — CID 2180875
4-chloro-3-[5-[(Z)-[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2180875) has the molecular formula C23H13Cl2N2O6- and a molecular weight of 484.27 g/mol. Its IUPAC name is 4-chloro-3-[5-[(Z)-[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 4-chloro-3-[5-[(Z)-[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2180875 |
| Molecular Formula | C23H13Cl2N2O6- |
| Molecular Weight | 484.27 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | 4-chloro-3-[5-[(Z)-[1-(3-chloro-4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | Cc1ccc(N2C(=O)NC(=O)/C(=C/c3ccc(-c4cc(C(=O)[O-])ccc4Cl)o3)C2=O)cc1Cl |
| InChI | InChI=1S/C23H14Cl2N2O6/c1-11-2-4-13(9-18(11)25)27-21(29)16(20(28)26-23(27)32)10-14-5-7-19(33-14)15-8-12(22(30)31)3-6-17(15)24/h2-10H,1H3,(H,30,31)(H,26,28,32)/p-1/b16-10- |
| InChIKey | CHLQDVQYYUZQQR-YBEGLDIGSA-M |
| XLogP | 3.59 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|