C24H16ClN2O5S- — CID 2188213
3-[5-[(Z)-[1-(3-chloro-2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-4-methylbenzoate (PubChem CID 2188213) has the molecular formula C24H16ClN2O5S- and a molecular weight of 479.92 g/mol. Its IUPAC name is 3-[5-[(Z)-[1-(3-chloro-2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-4-methylbenzoate.
| Compound Name | 3-[5-[(Z)-[1-(3-chloro-2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 2188213 |
| Molecular Formula | C24H16ClN2O5S- |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 3-[5-[(Z)-[1-(3-chloro-2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1-c1ccc(/C=C2/C(=O)NC(=S)N(c3cccc(Cl)c3C)C2=O)o1 |
| InChI | InChI=1S/C24H17ClN2O5S/c1-12-6-7-14(23(30)31)10-16(12)20-9-8-15(32-20)11-17-21(28)26-24(33)27(22(17)29)19-5-3-4-18(25)13(19)2/h3-11H,1-2H3,(H,30,31)(H,26,28,33)/p-1/b17-11- |
| InChIKey | CHONILMKDCDFRI-BOPFTXTBSA-M |
| XLogP | 3.41 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|