C23H16Cl2N2O3S — CID 4002961
5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 4002961) has the molecular formula C23H16Cl2N2O3S and a molecular weight of 471.37 g/mol. Its IUPAC name is 5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 4002961 |
| Molecular Formula | C23H16Cl2N2O3S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 5-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3ccc(-c4cccc(Cl)c4Cl)o3)C(=O)NC2=S)c(C)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3S/c1-12-6-8-18(13(2)10-12)27-22(29)16(21(28)26-23(27)31)11-14-7-9-19(30-14)15-4-3-5-17(24)20(15)25/h3-11H,1-2H3,(H,26,28,31) |
| InChIKey | NVUKORQUPZTYNX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|