C23H16N2O7 — CID 1270258
4-[5-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 1270258) has the molecular formula C23H16N2O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is 4-[5-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1270258 |
| Molecular Formula | C23H16N2O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-[5-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(-c4ccc(C(=O)O)cc4)o3)C2=O)cc1 |
| InChI | InChI=1S/C23H16N2O7/c1-31-16-8-6-15(7-9-16)25-21(27)18(20(26)24-23(25)30)12-17-10-11-19(32-17)13-2-4-14(5-3-13)22(28)29/h2-12H,1H3,(H,28,29)(H,24,26,30) |
| InChIKey | CUGLMODKGGEERJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|