C23H16N2O6 — CID 96885762
methyl 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 96885762) has the molecular formula C23H16N2O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is methyl 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 96885762 |
| Molecular Formula | C23H16N2O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | methyl 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=C3\C(=O)NC(=O)N(c4ccccc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C23H16N2O6/c1-30-22(28)15-9-7-14(8-10-15)19-12-11-17(31-19)13-18-20(26)24-23(29)25(21(18)27)16-5-3-2-4-6-16/h2-13H,1H3,(H,24,26,29)/b18-13+ |
| InChIKey | ARZODFPIOPIULX-QGOAFFKASA-N |
| XLogP | 3.40 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|