C22H13N3O4 — CID 6517121
4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile (PubChem CID 6517121) has the molecular formula C22H13N3O4 and a molecular weight of 383.36 g/mol. Its IUPAC name is 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 6517121 |
| Molecular Formula | C22H13N3O4 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-[5-[(E)-(2,4,6-trioxo-1-phenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=C3\C(=O)NC(=O)N(c4ccccc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C22H13N3O4/c23-13-14-6-8-15(9-7-14)19-11-10-17(29-19)12-18-20(26)24-22(28)25(21(18)27)16-4-2-1-3-5-16/h1-12H,(H,24,26,28)/b18-12+ |
| InChIKey | BNFCYBWCLNASPQ-LDADJPATSA-N |
| XLogP | 3.48 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|