C21H12N4O4 — CID 126398981
4-[5-[(E)-(2,4,6-trioxo-1-pyridin-4-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile (PubChem CID 126398981) has the molecular formula C21H12N4O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-4-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-4-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126398981 |
| Molecular Formula | C21H12N4O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-4-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=C3\C(=O)NC(=O)N(c4ccncc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C21H12N4O4/c22-12-13-1-3-14(4-2-13)18-6-5-16(29-18)11-17-19(26)24-21(28)25(20(17)27)15-7-9-23-10-8-15/h1-11H,(H,24,26,28)/b17-11+ |
| InChIKey | AJAOBHSCPLFDCP-GZTJUZNOSA-N |
| XLogP | 2.88 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|