C23H17N3O6 — CID 126238592
ethyl 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-3-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 126238592) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-3-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-3-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126238592 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | ethyl 4-[5-[(E)-(2,4,6-trioxo-1-pyridin-3-yl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3\C(=O)NC(=O)N(c4cccnc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C23H17N3O6/c1-2-31-22(29)15-7-5-14(6-8-15)19-10-9-17(32-19)12-18-20(27)25-23(30)26(21(18)28)16-4-3-11-24-13-16/h3-13H,2H2,1H3,(H,25,27,30)/b18-12+ |
| InChIKey | OSUMINKXTXCBJR-LDADJPATSA-N |
| XLogP | 3.18 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|