C24H17ClN2O5S — CID 3771907
ethyl 4-[5-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 3771907) has the molecular formula C24H17ClN2O5S and a molecular weight of 480.93 g/mol. Its IUPAC name is ethyl 4-[5-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3771907 |
| Molecular Formula | C24H17ClN2O5S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | ethyl 4-[5-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3C(=O)NC(=S)N(c4ccc(Cl)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H17ClN2O5S/c1-2-31-23(30)15-5-3-14(4-6-15)20-12-11-18(32-20)13-19-21(28)26-24(33)27(22(19)29)17-9-7-16(25)8-10-17/h3-13H,2H2,1H3,(H,26,28,33) |
| InChIKey | XVBVSRMIWGWZGX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|