C25H18N2O7S — CID 3642662
3-[5-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3642662) has the molecular formula C25H18N2O7S and a molecular weight of 490.49 g/mol. Its IUPAC name is 3-[5-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3642662 |
| Molecular Formula | C25H18N2O7S |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 3-[5-[[5-(4-ethoxycarbonylphenyl)furan-2-yl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C3C(=O)NC(=S)N(c4cccc(C(=O)O)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H18N2O7S/c1-2-33-24(32)15-8-6-14(7-9-15)20-11-10-18(34-20)13-19-21(28)26-25(35)27(22(19)29)17-5-3-4-16(12-17)23(30)31/h3-13H,2H2,1H3,(H,30,31)(H,26,28,35) |
| InChIKey | MTVUPXRJGQSPFB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|