C23H13ClN2O7S — CID 4566532
5-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid (PubChem CID 4566532) has the molecular formula C23H13ClN2O7S and a molecular weight of 496.88 g/mol. Its IUPAC name is 5-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 4566532 |
| Molecular Formula | C23H13ClN2O7S |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 5-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=Cc1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C23H13ClN2O7S/c24-17-6-4-11(9-15(17)22(31)32)18-7-5-14(33-18)10-16-19(27)25-23(34)26(20(16)28)13-3-1-2-12(8-13)21(29)30/h1-10H,(H,29,30)(H,31,32)(H,25,27,34) |
| InChIKey | OEBFGIPJVIPBEP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|