C23H13F3N2O5S — CID 126256229
2-[5-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126256229) has the molecular formula C23H13F3N2O5S and a molecular weight of 486.43 g/mol. Its IUPAC name is 2-[5-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126256229 |
| Molecular Formula | C23H13F3N2O5S |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 2-[5-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(F)(F)F)c2)C(=O)/C1=C/c1ccc(-c2ccccc2C(=O)O)o1 |
| InChI | InChI=1S/C23H13F3N2O5S/c24-23(25,26)12-4-3-5-13(10-12)28-20(30)17(19(29)27-22(28)34)11-14-8-9-18(33-14)15-6-1-2-7-16(15)21(31)32/h1-11H,(H,31,32)(H,27,29,34)/b17-11+ |
| InChIKey | MEIFVYZQSIRMAF-GZTJUZNOSA-N |
| XLogP | 4.49 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|