C25H20N2O5S — CID 1016049
ethyl 2-[5-[(Z)-[1-(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 1016049) has the molecular formula C25H20N2O5S and a molecular weight of 460.51 g/mol. Its IUPAC name is ethyl 2-[5-[(Z)-[1-(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-[5-[(Z)-[1-(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 1016049 |
| Molecular Formula | C25H20N2O5S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | ethyl 2-[5-[(Z)-[1-(4-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1ccc(/C=C2/C(=O)NC(=S)N(c3ccc(C)cc3)C2=O)o1 |
| InChI | InChI=1S/C25H20N2O5S/c1-3-31-24(30)19-7-5-4-6-18(19)21-13-12-17(32-21)14-20-22(28)26-25(33)27(23(20)29)16-10-8-15(2)9-11-16/h4-14H,3H2,1-2H3,(H,26,28,33)/b20-14- |
| InChIKey | FQVYRZIXNQSVRU-ZHZULCJRSA-N |
| XLogP | 4.26 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|