C24H18N2O6S — CID 1006718
3-[5-[(E)-[1-(2-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 1006718) has the molecular formula C24H18N2O6S and a molecular weight of 462.48 g/mol. Its IUPAC name is 3-[5-[(E)-[1-(2-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[(E)-[1-(2-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 1006718 |
| Molecular Formula | C24H18N2O6S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 3-[5-[(E)-[1-(2-methoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | COc1ccccc1N1C(=O)/C(=C/c2ccc(-c3cccc(C(=O)O)c3C)o2)C(=O)NC1=S |
| InChI | InChI=1S/C24H18N2O6S/c1-13-15(6-5-7-16(13)23(29)30)19-11-10-14(32-19)12-17-21(27)25-24(33)26(22(17)28)18-8-3-4-9-20(18)31-2/h3-12H,1-2H3,(H,29,30)(H,25,27,33)/b17-12+ |
| InChIKey | DQIDRYTUVQVPAV-SFQUDFHCSA-N |
| XLogP | 3.79 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|