C22H16N2O5 — CID 1308083
3-[5-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 1308083) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is 3-[5-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 3-[5-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 1308083 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[5-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1-c1ccc(/C=C2/NC(=O)N(c3ccccc3)C2=O)o1 |
| InChI | InChI=1S/C22H16N2O5/c1-13-16(8-5-9-17(13)21(26)27)19-11-10-15(29-19)12-18-20(25)24(22(28)23-18)14-6-3-2-4-7-14/h2-12H,1H3,(H,23,28)(H,26,27)/b18-12+ |
| InChIKey | BOOSVHLICMMPFN-LDADJPATSA-N |
| XLogP | 4.05 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|